![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | NECE-Q-04725.jpg | 2006-09-15 20:00 | 942K | |
![[IMG]](/icons/image2.gif) | NECE-Q-04726.jpg | 2006-09-15 20:01 | 803K | |
![[IMG]](/icons/image2.gif) | NECE-Q-04727.jpg | 2006-09-15 20:01 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-04741.jpg | 2006-09-15 20:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-04742.jpg | 2006-09-15 20:07 | 950K | |
![[IMG]](/icons/image2.gif) | NECE-Q-04743.jpg | 2006-09-15 20:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-04744.jpg | 2006-09-15 20:08 | 912K | |
![[IMG]](/icons/image2.gif) | NECE-Q-04745.jpg | 2006-09-15 20:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-04746.jpg | 2006-09-15 20:09 | 916K | |
![[IMG]](/icons/image2.gif) | NECE-Q-04747.jpg | 2006-09-15 20:09 | 881K | |
![[IMG]](/icons/image2.gif) | NECE-Q-04748.jpg | 2006-09-15 20:10 | 910K | |
![[IMG]](/icons/image2.gif) | NECE-Q-About Pool 1 looking toward Pool 2-04681.jpg | 2006-09-15 17:32 | 580K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Above Pool # 1-04688.jpg | 2006-09-15 17:42 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Bear Bluff and Tower-05794.jpg | 2006-09-21 15:32 | 946K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Beaver flooding south of Sprague Road-04686.jpg | 2006-09-15 17:40 | 909K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Beaver pools on Rattail-04678.jpg | 2006-09-15 17:28 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Blair Unit--01534.jpg | 2006-09-05 14:39 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield-Irontop-04414.jpg | 2006-09-15 10:49 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield Agriculture Units-04404.jpg | 2006-09-15 10:38 | 826K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield Control Structure-04740.jpg | 2006-09-15 20:07 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield Farm Unit-04697.jpg | 2006-09-15 17:54 | 805K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield Fields-04702.jpg | 2006-09-16 06:32 | 793K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield topping IronTop-04711.jpg | 2006-09-15 19:54 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield Units--01488.jpg | 2006-09-05 12:54 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Canfield Units-01553.jpg | 2006-09-05 15:38 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carpenter Tract-04715.jpg | 2006-09-15 19:56 | 805K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carpenter Unit--01535.jpg | 2006-09-05 14:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carpenter Wait-04717.jpg | 2006-09-15 19:57 | 682K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carter-04714.jpg | 2006-09-15 19:56 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carter-04716.jpg | 2006-09-15 19:57 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carter-Woggon Pool, 2d year of high water-01480.jpg | 2006-09-05 10:30 | 594K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Carter-Woggon Pool after 2 years of managed high water--01481.jpg | 2006-09-05 10:31 | 916K | |
![[IMG]](/icons/image2.gif) | NECE-Q-County Line-04749.jpg | 2006-09-15 20:10 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Cranberry Marsh-04388.jpg | 2006-09-15 09:33 | 841K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Deer trails and deer-02613.jpg | 2006-09-09 16:12 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Dike-04703.jpg | 2006-09-15 19:50 | 887K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Eagle Nest-.jpg | 2006-09-15 19:58 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-East side of refuge-04682.jpg | 2006-09-15 17:33 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-eer Trails-04739.jpg | 2006-09-15 20:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Findysz Place-04415.jpg | 2006-09-15 10:50 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Goose Pool, Upper-04662.jpg | 2006-09-15 17:03 | 964K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Goose Pool-04648.jpg | 2006-09-15 16:45 | 858K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Goose Pool-04683.jpg | 2006-09-15 17:35 | 881K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Goose Pool-04707.jpg | 2006-09-15 19:52 | 869K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Goose Pool-04723.jpg | 2006-09-15 19:59 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Irentop Farm Unit-01551.jpg | 2006-09-05 15:36 | 727K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Jack Pine, Aspen & Oak-04391.jpg | 2006-09-15 09:36 | 795K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Marsh deer trails-02612.jpg | 2006-09-09 16:11 | 904K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah-04427.jpg | 2006-09-15 11:01 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Air Strips-04410.jpg | 2006-09-15 10:45 | 958K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah high water floods large area in spring-04423.jpg | 2006-09-15 10:57 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge-04396.jpg | 2006-09-15 10:31 | 729K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge-04397.jpg | 2006-09-15 10:32 | 726K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge-04402.jpg | 2006-09-15 10:39 | 488K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge-04409.jpg | 2006-09-15 10:44 | 649K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge Hdqs-04393.jpg | 2006-09-15 11:03 | 631K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge Hdqs-04398.jpg | 2006-09-22 18:42 | 615K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge Hdqs-04399.jpg | 2006-09-15 10:34 | 603K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge Hdqs-04406.jpg | 2006-09-15 10:41 | 692K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge Hdqs-04656.jpg | 2006-09-15 16:56 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Necedah Refuge Hqds-04400.jpg | 2006-09-15 10:35 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-New Pool-04728.jpg | 2006-09-15 20:01 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-New pools, west end Cover Road- 04736.jpg | 2006-09-15 20:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-N Finley-04752.jpg | 2006-09-15 20:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-ool 19-04731.jpg | 2006-09-15 20:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Parham-Becker Unit-04660.jpg | 2006-09-15 17:01 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Perham Farm Unit-01526.jpg | 2006-09-05 13:57 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Petenwell Flowage-04405.jpg | 2006-09-15 10:40 | 504K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Plantation Fire-04403.jpg | 2006-09-15 10:38 | 1.5M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 1-04691.jpg | 2006-09-15 17:45 | 758K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 1-04730.jpg | 2006-09-15 20:02 | 888K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 2-04737.jpg | 2006-09-15 20:06 | 928K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 9-04677.jpg | 2006-09-15 17:26 | 819K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 9-04685.jpg | 2006-09-15 17:38 | 956K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 9-04704.jpg | 2006-09-15 19:51 | 924K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 13-04676.jpg | 2006-09-15 17:25 | 930K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 13 Area-04665.jpg | 2006-09-15 17:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 15-04689.jpg | 2006-09-15 17:43 | 884K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 18-04653.jpg | 2006-09-15 16:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 18-04670.jpg | 2006-09-15 17:17 | 956K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 18-04680.jpg | 2006-09-15 17:30 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 18-04706.jpg | 2006-09-15 19:51 | 835K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 18-04712.jpg | 2006-09-15 19:55 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 19-04392.jpg | 2006-09-15 09:37 | 914K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 19-04411.jpg | 2006-09-15 10:46 | 1.4M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 19-04646.jpg | 2006-09-15 16:43 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 19-04674.jpg | 2006-09-15 17:22 | 946K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 19-04708.jpg | 2006-09-15 19:52 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 27-04383.jpg | 2006-09-15 09:29 | 803K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 27-04651.jpg | 2006-09-15 16:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 27-04673.jpg | 2006-09-15 17:22 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 27-28-04382.jpg | 2006-09-15 09:28 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 28-04384.jpg | 2006-09-15 09:30 | 755K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 28-04658.jpg | 2006-09-15 16:59 | 865K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 29-04422.jpg | 2006-09-15 10:56 | 789K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pool 1704729.jpg | 2006-09-15 20:02 | 953K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pools 9 & 13-04650.jpg | 2006-09-15 16:49 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Pools 9 & 13 Flooding Summer 1964-04407.jpg | 2006-09-15 10:42 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Potholes North of Finley-04424.jpg | 2006-09-15 10:58 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Prescribed Burn-04709.jpg | 2006-09-15 19:53 | 1.3M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Prescribed Burn-04710.jpg | 2006-09-15 19:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson-05796.jpg | 2006-09-21 08:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1 & Laske Field-04654.jpg | 2006-09-15 16:52 | 777K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1, haul roads for timber sale-04663.jpg | 2006-09-15 17:05 | 969K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1-04390.jpg | 2006-09-15 09:35 | 825K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1-04413.jpg | 2006-09-15 10:48 | 1.4M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1-04652.jpg | 2006-09-15 16:50 | 817K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1-04679.jpg | 2006-09-15 17:29 | 724K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1-04718.jpg | 2006-09-15 19:57 | 935K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1-North fire lane-04421.jpg | 2006-09-15 10:55 | 796K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1 landing Site-04389.jpg | 2006-09-15 09:34 | 616K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1 margin clearing-04417.jpg | 2006-09-15 10:51 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1 margin Clearing-04420.jpg | 2006-09-15 10:54 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 1 prior to timber cut-04425.jpg | 2006-09-15 10:59 | 804K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 2-04381.jpg | 2006-09-15 09:27 | 588K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 2-04657.jpg | 2006-09-15 16:58 | 706K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Rynearson Pool 2-After timber cut-04655.jpg | 2006-09-15 16:54 | 868K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sandstone Scientific Area-04713.jpg | 2006-09-15 19:55 | 1.8M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Secondary Farm Units-01531.jpg | 2006-09-05 14:38 | 1.4M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Speedway-04684.jpg | 2006-09-15 17:36 | 814K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Speedway-04696.jpg | 2006-09-15 17:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Speedway-04734.jpg | 2006-09-15 20:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague-04698.jpg | 2006-09-15 17:56 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague-Mather Pool-04401.jpg | 2006-09-15 10:37 | 486K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, East-04661.jpg | 2006-09-15 17:02 | 796K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, low dike between Pool 29-04699.jpg | 2006-09-15 17:57 | 653K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, Upper-04426.jpg | 2006-09-15 11:00 | 768K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, Upper-04645.jpg | 2006-09-15 16:42 | 863K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, Upper-04647.jpg | 2006-09-15 16:44 | 783K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, Upper-04667.jpg | 2006-09-15 17:13 | 800K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, Upper-04669.jpg | 2006-09-15 17:16 | 718K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool, West-04671.jpg | 2006-09-15 17:18 | 888K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04385.jpg | 2006-09-15 09:31 | 965K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04386.jpg | 2006-09-15 09:31 | 721K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04387.jpg | 2006-09-15 09:32 | 674K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04408.jpg | 2006-09-15 10:43 | 596K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04412.jpg | 2006-09-15 10:47 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04416.jpg | 2006-09-15 10:51 | 1.4M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04418.jpg | 2006-09-15 10:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04692.jpg | 2006-09-15 17:47 | 958K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04693.jpg | 2006-09-15 17:48 | 954K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04695.jpg | 2006-09-15 17:51 | 963K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04705.jpg | 2006-09-15 19:51 | 762K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool-04719.jpg | 2006-09-15 19:58 | 858K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool 2 farm units-04687.jpg | 2006-09-15 17:41 | 620K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague pool and Hwy 80-04720.jpg | 2006-09-15 19:58 | 854K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Sprague Pool East-04649.jpg | 2006-09-15 16:45 | 908K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Suk Caerney-04724.jpg | 2006-09-15 20:00 | 889K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Suk Carney-04732.jpg | 2006-09-15 20:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Suk Carney west-04733.jpg | 2006-09-15 20:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Suk Cerney-04738.jpg | 2006-09-15 20:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Thinned pine Plantation along Speedway-04419.jpg | 2006-09-15 10:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Timber View-04395.jpg | 2006-09-15 10:31 | 1.4M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Turkey Tract-04735.jpg | 2006-09-15 20:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Williams-04694.jpg | 2006-09-15 17:50 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Wood County Line-04722.jpg | 2006-09-15 19:59 | 922K | |
![[IMG]](/icons/image2.gif) | NECE-Q-Wood County Line-04750.jpg | 2006-09-15 20:10 | 1.2M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Wood County Line-04751.jpg | 2006-09-15 20:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | NECE-Q-Yellow River-04394.jpg | 2006-09-15 10:30 | 1.0M | |
|